About 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one
1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one (PubChem CID 70711227) has the molecular formula C18H25N3O3S
and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one |
| PubChem CID | 70711227 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one |
| SMILES | O=C1N(CC2CCCS(=O)(=O)C2)c2ccccc2NC12CCNCC2 |
| InChI | InChI=1S/C18H25N3O3S/c22-17-18(7-9-19-10-8-18)20-15-5-1-2-6-16(15)21(17)12-14-4-3-11-25(23,24)13-14/h1-2,5-6,14,19-20H,3-4,7-13H2 |
| InChIKey | VDFVCRSTUYRCGU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one?
The IUPAC name of 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one (CID 70711227) is 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one.
What is the SMILES notation for 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one?
The canonical SMILES for 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one is O=C1N(CC2CCCS(=O)(=O)C2)c2ccccc2NC12CCNCC2.
What is the InChIKey of 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one?
The InChIKey is VDFVCRSTUYRCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O3S/c22-17-18(7-9-19-10-8-18)20-15-5-1-2-6-16(15)21(17)12-14-4-3-11-25(23,24)13-14/h1-2,5-6,14,19-20H,3-4,7-13H2.
What are the key properties of 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one?
1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one has a molecular weight of 363.48 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothian-3-yl)methyl]spiro[4H-quinoxaline-3,4'-piperidine]-2-one is sourced from PubChem (CID 70711227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).