About N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine
N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 70711370) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 70711370 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Cc1cccn2c(CNc3ccc4cc[nH]c4n3)cnc12 |
| InChI | InChI=1S/C16H15N5/c1-11-3-2-8-21-13(10-19-16(11)21)9-18-14-5-4-12-6-7-17-15(12)20-14/h2-8,10H,9H2,1H3,(H2,17,18,20) |
| InChIKey | MUUUDMSYFHRLBA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 70711370) is N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine is Cc1cccn2c(CNc3ccc4cc[nH]c4n3)cnc12.
What is the InChIKey of N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is MUUUDMSYFHRLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-11-3-2-8-21-13(10-19-16(11)21)9-18-14-5-4-12-6-7-17-15(12)20-14/h2-8,10H,9H2,1H3,(H2,17,18,20).
What are the key properties of N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 277.33 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 70711370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).