C22H24ClN3O2 — CID 70711620
1-[[3-(2-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]piperidin-3-ol (PubChem CID 70711620) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]piperidin-3-ol.
| Compound Name | 1-[[3-(2-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 70711620 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-4-yl]methyl]piperidin-3-ol |
| SMILES | COc1ccc(-n2cc(CN3CCCC(O)C3)c(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-28-19-10-8-17(9-11-19)26-14-16(13-25-12-4-5-18(27)15-25)22(24-26)20-6-2-3-7-21(20)23/h2-3,6-11,14,18,27H,4-5,12-13,15H2,1H3 |
| InChIKey | SKZLTZWMMLFBAL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |