C21H28N2O2S — CID 70712057
(4aR,7aS)-4-[(5-methylnaphthalen-1-yl)methyl]-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70712057) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is (4aR,7aS)-4-[(5-methylnaphthalen-1-yl)methyl]-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(5-methylnaphthalen-1-yl)methyl]-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70712057 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (4aR,7aS)-4-[(5-methylnaphthalen-1-yl)methyl]-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCCN1CCN(Cc2cccc3c(C)cccc23)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C21H28N2O2S/c1-3-10-22-11-12-23(21-15-26(24,25)14-20(21)22)13-17-7-5-8-18-16(2)6-4-9-19(17)18/h4-9,20-21H,3,10-15H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | NUXQIJNHZSPJEH-RTWAWAEBSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |