C24H28N2O2 — CID 70712219
(1S,3R)-7-[(1-benzylindol-6-yl)methyl]-7-azaspiro[3.5]nonane-1,3-diol (PubChem CID 70712219) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (1S,3R)-7-[(1-benzylindol-6-yl)methyl]-7-azaspiro[3.5]nonane-1,3-diol.
| Compound Name | (1S,3R)-7-[(1-benzylindol-6-yl)methyl]-7-azaspiro[3.5]nonane-1,3-diol |
|---|---|
| PubChem CID | 70712219 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1S,3R)-7-[(1-benzylindol-6-yl)methyl]-7-azaspiro[3.5]nonane-1,3-diol |
| SMILES | O[C@@H]1C[C@H](O)C12CCN(Cc1ccc3ccn(Cc4ccccc4)c3c1)CC2 |
| InChI | InChI=1S/C24H28N2O2/c27-22-15-23(28)24(22)9-12-25(13-10-24)16-19-6-7-20-8-11-26(21(20)14-19)17-18-4-2-1-3-5-18/h1-8,11,14,22-23,27-28H,9-10,12-13,15-17H2/t22-,23+ |
| InChIKey | NHYOSJZHJKOSFY-ZRZAMGCNSA-N |
| XLogP | 3.40 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |