C19H27N3O4 — CID 70712302
(1R,7S)-3-(2-ethylbutyl)-6-(3-oxopiperazine-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 70712302) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1R,7S)-3-(2-ethylbutyl)-6-(3-oxopiperazine-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,7S)-3-(2-ethylbutyl)-6-(3-oxopiperazine-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 70712302 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1R,7S)-3-(2-ethylbutyl)-6-(3-oxopiperazine-1-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | CCC(CC)CN1C[C@]23C=C[C@H](O2)C(C(=O)N2CCNC(=O)C2)C3C1=O |
| InChI | InChI=1S/C19H27N3O4/c1-3-12(4-2)9-22-11-19-6-5-13(26-19)15(16(19)18(22)25)17(24)21-8-7-20-14(23)10-21/h5-6,12-13,15-16H,3-4,7-11H2,1-2H3,(H,20,23)/t13-,15?,16?,19-/m0/s1 |
| InChIKey | OBFMYNXCPFIINW-FGAHCWIFSA-N |
| XLogP | 0.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|