About 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide
1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 70712693) has the molecular formula C16H23N3O2S
and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| PubChem CID | 70712693 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1nc(CCCNC(=O)C2CC(=O)N(C3CC3)C2)sc1C |
| InChI | InChI=1S/C16H23N3O2S/c1-10-11(2)22-14(18-10)4-3-7-17-16(21)12-8-15(20)19(9-12)13-5-6-13/h12-13H,3-9H2,1-2H3,(H,17,21) |
| InChIKey | JDNFYYCYCKFXPV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide?
The IUPAC name of 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide (CID 70712693) is 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide?
The canonical SMILES for 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide is Cc1nc(CCCNC(=O)C2CC(=O)N(C3CC3)C2)sc1C.
What is the InChIKey of 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide?
The InChIKey is JDNFYYCYCKFXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2S/c1-10-11(2)22-14(18-10)4-3-7-17-16(21)12-8-15(20)19(9-12)13-5-6-13/h12-13H,3-9H2,1-2H3,(H,17,21).
What are the key properties of 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide?
1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide has a molecular weight of 321.45 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 70712693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).