C14H20N4O5S2 — CID 70712898
(4aR,7aS)-N,N-dimethyl-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-sulfonamide (PubChem CID 70712898) has the molecular formula C14H20N4O5S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (4aR,7aS)-N,N-dimethyl-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-sulfonamide.
| Compound Name | (4aR,7aS)-N,N-dimethyl-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-sulfonamide |
|---|---|
| PubChem CID | 70712898 |
| Molecular Formula | C14H20N4O5S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (4aR,7aS)-N,N-dimethyl-6,6-dioxo-1-(pyridine-2-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)c2ccccn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H20N4O5S2/c1-16(2)25(22,23)18-8-7-17(12-9-24(20,21)10-13(12)18)14(19)11-5-3-4-6-15-11/h3-6,12-13H,7-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | IWFFVBXEVIHCSK-OLZOCXBDSA-N |
| XLogP | -1.19 |
| TPSA | 107.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |