C18H25N5O4 — CID 70714261
8-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 70714261) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 8-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 70714261 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 8-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)-1-ethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC(=O)C12CCN(C(=O)c1cnc(C(C)(C)C)[nH]c1=O)CC2 |
| InChI | InChI=1S/C18H25N5O4/c1-5-23-16(27)21-15(26)18(23)6-8-22(9-7-18)13(25)11-10-19-14(17(2,3)4)20-12(11)24/h10H,5-9H2,1-4H3,(H,19,20,24)(H,21,26,27) |
| InChIKey | PLXCHNYYWRSAHO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|