C15H23N7O2S — CID 70714372
N-[[5-[4-(ethylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]methanesulfonamide (PubChem CID 70714372) has the molecular formula C15H23N7O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[[5-[4-(ethylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[5-[4-(ethylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 70714372 |
| Molecular Formula | C15H23N7O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[[5-[4-(ethylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]methanesulfonamide |
| SMILES | CCNc1ccnc(N2CCCn3nc(CNS(C)(=O)=O)cc3C2)n1 |
| InChI | InChI=1S/C15H23N7O2S/c1-3-16-14-5-6-17-15(19-14)21-7-4-8-22-13(11-21)9-12(20-22)10-18-25(2,23)24/h5-6,9,18H,3-4,7-8,10-11H2,1-2H3,(H,16,17,19) |
| InChIKey | UJWPNRWPZLEHOC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |