C19H17N3O4 — CID 70714476
2-[4-(2-hydroxy-4-methoxybenzoyl)-2-oxopiperazin-1-yl]benzonitrile (PubChem CID 70714476) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[4-(2-hydroxy-4-methoxybenzoyl)-2-oxopiperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-(2-hydroxy-4-methoxybenzoyl)-2-oxopiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70714476 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[4-(2-hydroxy-4-methoxybenzoyl)-2-oxopiperazin-1-yl]benzonitrile |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccccc3C#N)C(=O)C2)c(O)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-26-14-6-7-15(17(23)10-14)19(25)21-8-9-22(18(24)12-21)16-5-3-2-4-13(16)11-20/h2-7,10,23H,8-9,12H2,1H3 |
| InChIKey | DHFNRMLXIVSQTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |