C17H23N7O — CID 70714900
[2-[[(2-aminopyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone (PubChem CID 70714900) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is [2-[[(2-aminopyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone.
| Compound Name | [2-[[(2-aminopyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 70714900 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [2-[[(2-aminopyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone |
| SMILES | Nc1nccc(NCc2cc3n(n2)CCCN(C(=O)C2CCC2)C3)n1 |
| InChI | InChI=1S/C17H23N7O/c18-17-19-6-5-15(21-17)20-10-13-9-14-11-23(7-2-8-24(14)22-13)16(25)12-3-1-4-12/h5-6,9,12H,1-4,7-8,10-11H2,(H3,18,19,20,21) |
| InChIKey | JGSCMCYOVQJDLT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |