About 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate
2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 70714926) has the molecular formula C16H26N4O3
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate |
| PubChem CID | 70714926 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | Cn1ncc(N2CCC(CNC(=O)OCC(C)(C)C)C2)cc1=O |
| InChI | InChI=1S/C16H26N4O3/c1-16(2,3)11-23-15(22)17-8-12-5-6-20(10-12)13-7-14(21)19(4)18-9-13/h7,9,12H,5-6,8,10-11H2,1-4H3,(H,17,22) |
| InChIKey | OOWSFESZRAFUAB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate?
The IUPAC name of 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate (CID 70714926) is 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate.
What is the SMILES notation for 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate?
The canonical SMILES for 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate is Cn1ncc(N2CCC(CNC(=O)OCC(C)(C)C)C2)cc1=O.
What is the InChIKey of 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate?
The InChIKey is OOWSFESZRAFUAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O3/c1-16(2,3)11-23-15(22)17-8-12-5-6-20(10-12)13-7-14(21)19(4)18-9-13/h7,9,12H,5-6,8,10-11H2,1-4H3,(H,17,22).
What are the key properties of 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate?
2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate has a molecular weight of 322.41 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl N-[[1-(1-methyl-6-oxopyridazin-4-yl)pyrrolidin-3-yl]methyl]carbamate is sourced from PubChem (CID 70714926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).