C15H20N4O4S — CID 70715211
[(4aR,7aS)-4-(2-methylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone (PubChem CID 70715211) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is [(4aR,7aS)-4-(2-methylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone.
| Compound Name | [(4aR,7aS)-4-(2-methylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 70715211 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(4aR,7aS)-4-(2-methylpyrazole-3-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-cyclopropylmethanone |
| SMILES | Cn1nccc1C(=O)N1CCN(C(=O)C2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H20N4O4S/c1-17-11(4-5-16-17)15(21)19-7-6-18(14(20)10-2-3-10)12-8-24(22,23)9-13(12)19/h4-5,10,12-13H,2-3,6-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | YFEMYRVIIHGNDU-OLZOCXBDSA-N |
| XLogP | -0.72 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |