C19H32ClN5O — CID 70715361
(4aS,8aR)-6-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70715361) has the molecular formula C19H32ClN5O and a molecular weight of 381.95 g/mol. Its IUPAC name is (4aS,8aR)-6-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70715361 |
| Molecular Formula | C19H32ClN5O |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (4aS,8aR)-6-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[2-(methylamino)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCCc1nc(Cl)c(CN2CC[C@@H]3[C@@H](CCC(=O)N3CCNC)C2)[nH]1 |
| InChI | InChI=1S/C19H32ClN5O/c1-3-4-5-17-22-15(19(20)23-17)13-24-10-8-16-14(12-24)6-7-18(26)25(16)11-9-21-2/h14,16,21H,3-13H2,1-2H3,(H,22,23)/t14-,16+/m0/s1 |
| InChIKey | GPUBEPXCRNOKST-GOEBONIOSA-N |
| XLogP | 2.44 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |