About (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone
(2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 70715586) has the molecular formula C19H16F3N3O2
and a molecular weight of 375.35 g/mol. Its IUPAC name is (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone |
| PubChem CID | 70715586 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc2nc(-c3ccccc3)cn2c1)N1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)16-12-24(8-9-27-16)18(26)14-6-7-17-23-15(11-25(17)10-14)13-4-2-1-3-5-13/h1-7,10-11,16H,8-9,12H2 |
| InChIKey | VEHGVOOOEMDSHG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The IUPAC name of (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone (CID 70715586) is (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone.
What is the SMILES notation for (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The canonical SMILES for (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone is O=C(c1ccc2nc(-c3ccccc3)cn2c1)N1CCOC(C(F)(F)F)C1.
What is the InChIKey of (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The InChIKey is VEHGVOOOEMDSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3N3O2/c20-19(21,22)16-12-24(8-9-27-16)18(26)14-6-7-17-23-15(11-25(17)10-14)13-4-2-1-3-5-13/h1-7,10-11,16H,8-9,12H2.
What are the key properties of (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
(2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone has a molecular weight of 375.35 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylimidazo[1,2-a]pyridin-6-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone is sourced from PubChem (CID 70715586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).