About (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole
(3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole (PubChem CID 7071571) has the molecular formula C21H19FN2OS
and a molecular weight of 366.46 g/mol. Its IUPAC name is (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole |
| PubChem CID | 7071571 |
| Molecular Formula | C21H19FN2OS |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole |
| SMILES | CCOc1ccc(C2=NN(c3ccccc3F)[C@@H](c3cccs3)C2)cc1 |
| InChI | InChI=1S/C21H19FN2OS/c1-2-25-16-11-9-15(10-12-16)18-14-20(21-8-5-13-26-21)24(23-18)19-7-4-3-6-17(19)22/h3-13,20H,2,14H2,1H3/t20-/m1/s1 |
| InChIKey | JYRXOCJKYRHFOB-HXUWFJFHSA-N |
| XLogP | 5.64 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole?
The IUPAC name of (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole (CID 7071571) is (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole.
What is the SMILES notation for (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole?
The canonical SMILES for (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole is CCOc1ccc(C2=NN(c3ccccc3F)[C@@H](c3cccs3)C2)cc1.
What is the InChIKey of (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole?
The InChIKey is JYRXOCJKYRHFOB-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H19FN2OS/c1-2-25-16-11-9-15(10-12-16)18-14-20(21-8-5-13-26-21)24(23-18)19-7-4-3-6-17(19)22/h3-13,20H,2,14H2,1H3/t20-/m1/s1.
What are the key properties of (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole?
(3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole has a molecular weight of 366.46 g/mol, XLogP of 5.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-(4-ethoxyphenyl)-2-(2-fluorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazole is sourced from PubChem (CID 7071571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).