C18H21N7O2 — CID 70715725
2-[[(6-cyanopyridine-3-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide (PubChem CID 70715725) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[[(6-cyanopyridine-3-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide.
| Compound Name | 2-[[(6-cyanopyridine-3-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 70715725 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[[(6-cyanopyridine-3-carbonyl)amino]methyl]-N,N-dimethyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxamide |
| SMILES | CN(C)C(=O)N1CCCn2nc(CNC(=O)c3ccc(C#N)nc3)cc2C1 |
| InChI | InChI=1S/C18H21N7O2/c1-23(2)18(27)24-6-3-7-25-16(12-24)8-15(22-25)11-21-17(26)13-4-5-14(9-19)20-10-13/h4-5,8,10H,3,6-7,11-12H2,1-2H3,(H,21,26) |
| InChIKey | FRNRBLBFBTXPKG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |