C13H17F3N4O3S — CID 70716266
[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone (PubChem CID 70716266) has the molecular formula C13H17F3N4O3S and a molecular weight of 366.37 g/mol. Its IUPAC name is [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 70716266 |
| Molecular Formula | C13H17F3N4O3S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cc(C(F)(F)F)[nH]n2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H17F3N4O3S/c1-2-19-3-4-20(10-7-24(22,23)6-9(10)19)12(21)8-5-11(18-17-8)13(14,15)16/h5,9-10H,2-4,6-7H2,1H3,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | PYXRSLHVUYTBJT-ZJUUUORDSA-N |
| XLogP | 0.37 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |