C18H25FN2O2S — CID 70716525
(4aR,7aS)-1-(cyclopropylmethyl)-4-[(4-fluoro-3-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70716525) has the molecular formula C18H25FN2O2S and a molecular weight of 352.48 g/mol. Its IUPAC name is (4aR,7aS)-1-(cyclopropylmethyl)-4-[(4-fluoro-3-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(4-fluoro-3-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70716525 |
| Molecular Formula | C18H25FN2O2S |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(4-fluoro-3-methylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1cc(CN2CCN(CC3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)ccc1F |
| InChI | InChI=1S/C18H25FN2O2S/c1-13-8-15(4-5-16(13)19)10-21-7-6-20(9-14-2-3-14)17-11-24(22,23)12-18(17)21/h4-5,8,14,17-18H,2-3,6-7,9-12H2,1H3/t17-,18+/m1/s1 |
| InChIKey | DXZGABAFIKQVTR-MSOLQXFVSA-N |
| XLogP | 1.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |