C17H29N5O2 — CID 70716614
2-methyl-5-[2-[2-[(1-methylpiperidin-4-yl)amino]ethyl]morpholin-4-yl]pyridazin-3-one (PubChem CID 70716614) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-methyl-5-[2-[2-[(1-methylpiperidin-4-yl)amino]ethyl]morpholin-4-yl]pyridazin-3-one.
| Compound Name | 2-methyl-5-[2-[2-[(1-methylpiperidin-4-yl)amino]ethyl]morpholin-4-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 70716614 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 2-methyl-5-[2-[2-[(1-methylpiperidin-4-yl)amino]ethyl]morpholin-4-yl]pyridazin-3-one |
| SMILES | CN1CCC(NCCC2CN(c3cnn(C)c(=O)c3)CCO2)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-20-7-4-14(5-8-20)18-6-3-16-13-22(9-10-24-16)15-11-17(23)21(2)19-12-15/h11-12,14,16,18H,3-10,13H2,1-2H3 |
| InChIKey | AXBDKHXYFNMXPV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |