C25H27FNO+ — CID 7071710
(2S,3R,4R,6S)-3-ethyl-4-(4-fluorophenyl)-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 7071710) has the molecular formula C25H27FNO+ and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S,3R,4R,6S)-3-ethyl-4-(4-fluorophenyl)-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3R,4R,6S)-3-ethyl-4-(4-fluorophenyl)-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7071710 |
| Molecular Formula | C25H27FNO+ |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (2S,3R,4R,6S)-3-ethyl-4-(4-fluorophenyl)-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | CC[C@@H]1[C@@H](c2ccccc2)[NH2+][C@H](c2ccccc2)C[C@]1(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26FNO/c1-2-22-24(19-11-7-4-8-12-19)27-23(18-9-5-3-6-10-18)17-25(22,28)20-13-15-21(26)16-14-20/h3-16,22-24,27-28H,2,17H2,1H3/p+1/t22-,23+,24-,25+/m1/s1 |
| InChIKey | JEKQPZGODPLINH-RCTAOEEJSA-O |
| XLogP | 4.49 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |