C12H18F4N2O4S — CID 70717270
2-[(4aS,7aR)-6,6-dioxo-1-(3,3,4,4-tetrafluorobutyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid (PubChem CID 70717270) has the molecular formula C12H18F4N2O4S and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-[(4aS,7aR)-6,6-dioxo-1-(3,3,4,4-tetrafluorobutyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid.
| Compound Name | 2-[(4aS,7aR)-6,6-dioxo-1-(3,3,4,4-tetrafluorobutyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70717270 |
| Molecular Formula | C12H18F4N2O4S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-[(4aS,7aR)-6,6-dioxo-1-(3,3,4,4-tetrafluorobutyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCC(F)(F)C(F)F)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C12H18F4N2O4S/c13-11(14)12(15,16)1-2-17-3-4-18(5-10(19)20)9-7-23(21,22)6-8(9)17/h8-9,11H,1-7H2,(H,19,20)/t8-,9+/m0/s1 |
| InChIKey | IECSDSVDLODCEG-DTWKUNHWSA-N |
| XLogP | 0.14 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|