C20H30N4O3 — CID 70717538
(4aS,8aR)-1-[2-(methylamino)ethyl]-6-(2-oxo-6-propan-2-yl-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70717538) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(2-oxo-6-propan-2-yl-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(2-oxo-6-propan-2-yl-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70717538 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (4aS,8aR)-1-[2-(methylamino)ethyl]-6-(2-oxo-6-propan-2-yl-1H-pyridine-3-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CNCCN1C(=O)CC[C@H]2CN(C(=O)c3ccc(C(C)C)[nH]c3=O)CC[C@H]21 |
| InChI | InChI=1S/C20H30N4O3/c1-13(2)16-6-5-15(19(26)22-16)20(27)23-10-8-17-14(12-23)4-7-18(25)24(17)11-9-21-3/h5-6,13-14,17,21H,4,7-12H2,1-3H3,(H,22,26)/t14-,17+/m0/s1 |
| InChIKey | BACABSUSTSDWKW-WMLDXEAASA-N |
| XLogP | 1.17 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |