C21H27FN4O — CID 70717656
N-[[5-[(2-fluoro-5-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide (PubChem CID 70717656) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[[5-[(2-fluoro-5-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[5-[(2-fluoro-5-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 70717656 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-[[5-[(2-fluoro-5-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
| SMILES | Cc1ccc(F)c(CN2CCCn3nc(CNC(=O)C4CCC4)cc3C2)c1 |
| InChI | InChI=1S/C21H27FN4O/c1-15-6-7-20(22)17(10-15)13-25-8-3-9-26-19(14-25)11-18(24-26)12-23-21(27)16-4-2-5-16/h6-7,10-11,16H,2-5,8-9,12-14H2,1H3,(H,23,27) |
| InChIKey | ALKAWWLQJNSEKB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |