About 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine
4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine (PubChem CID 70717764) has the molecular formula C25H27N3O2
and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine |
| PubChem CID | 70717764 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2cn(Cc3ccccc3)nc2-c2cc3ccccc3o2)CCO1 |
| InChI | InChI=1S/C25H27N3O2/c1-25(2)18-27(12-13-29-25)16-21-17-28(15-19-8-4-3-5-9-19)26-24(21)23-14-20-10-6-7-11-22(20)30-23/h3-11,14,17H,12-13,15-16,18H2,1-2H3 |
| InChIKey | QMKAXVZNOBTEJG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine?
The IUPAC name of 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine (CID 70717764) is 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine.
What is the SMILES notation for 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine?
The canonical SMILES for 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine is CC1(C)CN(Cc2cn(Cc3ccccc3)nc2-c2cc3ccccc3o2)CCO1.
What is the InChIKey of 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine?
The InChIKey is QMKAXVZNOBTEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O2/c1-25(2)18-27(12-13-29-25)16-21-17-28(15-19-8-4-3-5-9-19)26-24(21)23-14-20-10-6-7-11-22(20)30-23/h3-11,14,17H,12-13,15-16,18H2,1-2H3.
What are the key properties of 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine?
4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine has a molecular weight of 401.51 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(1-benzofuran-2-yl)-1-benzylpyrazol-4-yl]methyl]-2,2-dimethylmorpholine is sourced from PubChem (CID 70717764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).