C16H27N3O4S — CID 70717794
2-[(4aR,7aS)-4-(cyclopentanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide (PubChem CID 70717794) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[(4aR,7aS)-4-(cyclopentanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aS)-4-(cyclopentanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 70717794 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[(4aR,7aS)-4-(cyclopentanecarbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(C(=O)C2CCCC2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H27N3O4S/c1-17(2)15(20)9-18-7-8-19(16(21)12-5-3-4-6-12)14-11-24(22,23)10-13(14)18/h12-14H,3-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | LKSQFUGAKWYVEM-KGLIPLIRSA-N |
| XLogP | -0.43 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |