C19H22N2O4 — CID 70717882
5-[4-(2-methoxyphenoxy)piperidine-1-carbonyl]-1-methylpyridin-2-one (PubChem CID 70717882) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-[4-(2-methoxyphenoxy)piperidine-1-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 5-[4-(2-methoxyphenoxy)piperidine-1-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 70717882 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 5-[4-(2-methoxyphenoxy)piperidine-1-carbonyl]-1-methylpyridin-2-one |
| SMILES | COc1ccccc1OC1CCN(C(=O)c2ccc(=O)n(C)c2)CC1 |
| InChI | InChI=1S/C19H22N2O4/c1-20-13-14(7-8-18(20)22)19(23)21-11-9-15(10-12-21)25-17-6-4-3-5-16(17)24-2/h3-8,13,15H,9-12H2,1-2H3 |
| InChIKey | NJGFAMBBFWSALA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |