C20H28N6O2 — CID 70718438
(4aS,8aR)-1-(3-methylbutyl)-6-(3-methyltriazolo[4,5-b]pyridine-6-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70718438) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-methylbutyl)-6-(3-methyltriazolo[4,5-b]pyridine-6-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-methylbutyl)-6-(3-methyltriazolo[4,5-b]pyridine-6-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70718438 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (4aS,8aR)-1-(3-methylbutyl)-6-(3-methyltriazolo[4,5-b]pyridine-6-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C(=O)c3cnc4c(c3)nnn4C)CC[C@H]21 |
| InChI | InChI=1S/C20H28N6O2/c1-13(2)6-9-26-17-7-8-25(12-14(17)4-5-18(26)27)20(28)15-10-16-19(21-11-15)24(3)23-22-16/h10-11,13-14,17H,4-9,12H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | WYKSWTOZSRCYRP-WMLDXEAASA-N |
| XLogP | 1.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |