C19H30N4OS — CID 70718609
1,10-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70718609) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is 1,10-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1,10-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70718609 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1,10-dimethyl-4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCC2(CCC1=O)CN(Cc1nc3c(s1)CCCC3)CCN2C |
| InChI | InChI=1S/C19H30N4OS/c1-21-10-9-19(8-7-18(21)24)14-23(12-11-22(19)2)13-17-20-15-5-3-4-6-16(15)25-17/h3-14H2,1-2H3 |
| InChIKey | NJGOVOLQRBLQRI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |