About 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine
5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70718913) has the molecular formula C16H25N5O2S
and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 70718913 |
| Molecular Formula | C16H25N5O2S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(NC2CCN(S(C)(=O)=O)CC2)n2nc(C)c(C)c2n1 |
| InChI | InChI=1S/C16H25N5O2S/c1-5-13-10-15(21-16(18-13)11(2)12(3)19-21)17-14-6-8-20(9-7-14)24(4,22)23/h10,14,17H,5-9H2,1-4H3 |
| InChIKey | BTHZRLBPSFDXON-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 70718913) is 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is CCc1cc(NC2CCN(S(C)(=O)=O)CC2)n2nc(C)c(C)c2n1.
What is the InChIKey of 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is BTHZRLBPSFDXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N5O2S/c1-5-13-10-15(21-16(18-13)11(2)12(3)19-21)17-14-6-8-20(9-7-14)24(4,22)23/h10,14,17H,5-9H2,1-4H3.
What are the key properties of 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine?
5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 351.48 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dimethyl-N-(1-methylsulfonylpiperidin-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 70718913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).