About N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide
N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 70719288) has the molecular formula C17H26N2O3S
and a molecular weight of 338.47 g/mol. Its IUPAC name is N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 70719288 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(C)C)sc1C(=O)NC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-11(2)16-18-12(3)14(23-16)15(20)19-13-4-7-22-17(10-13)5-8-21-9-6-17/h11,13H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | UOGPXXXMOZTQNQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide (CID 70719288) is N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide is Cc1nc(C(C)C)sc1C(=O)NC1CCOC2(CCOCC2)C1.
What is the InChIKey of N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
The InChIKey is UOGPXXXMOZTQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3S/c1-11(2)16-18-12(3)14(23-16)15(20)19-13-4-7-22-17(10-13)5-8-21-9-6-17/h11,13H,4-10H2,1-3H3,(H,19,20).
What are the key properties of N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide?
N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide has a molecular weight of 338.47 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,9-dioxaspiro[5.5]undecan-4-yl)-4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 70719288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).