C15H22N2O3 — CID 70719311
N-[(2S)-1-amino-1-oxopropan-2-yl]-3-(3-hydroxy-3-methylbutyl)benzamide (PubChem CID 70719311) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxopropan-2-yl]-3-(3-hydroxy-3-methylbutyl)benzamide.
| Compound Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-3-(3-hydroxy-3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 70719311 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-3-(3-hydroxy-3-methylbutyl)benzamide |
| SMILES | C[C@H](NC(=O)c1cccc(CCC(C)(C)O)c1)C(N)=O |
| InChI | InChI=1S/C15H22N2O3/c1-10(13(16)18)17-14(19)12-6-4-5-11(9-12)7-8-15(2,3)20/h4-6,9-10,20H,7-8H2,1-3H3,(H2,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | DNAHYJNXXDURTA-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |