C18H26N4O2 — CID 70719911
2-methyl-5-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyrimidin-6-one (PubChem CID 70719911) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-methyl-5-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 70719911 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-methyl-5-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H]1CN(C(=O)c1cnc(C)[nH]c1=O)C2 |
| InChI | InChI=1S/C18H26N4O2/c1-12(2)6-7-21-9-14-4-5-15(21)11-22(10-14)18(24)16-8-19-13(3)20-17(16)23/h6,8,14-15H,4-5,7,9-11H2,1-3H3,(H,19,20,23)/t14-,15-/m1/s1 |
| InChIKey | XSUBSUFQEUSNQA-HUUCEWRRSA-N |
| XLogP | 1.58 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|