About 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid
8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 70720121) has the molecular formula C18H21N3O2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
| PubChem CID | 70720121 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | O=C(O)C1CC2(CCN(c3nccc4ccccc34)CC2)CN1 |
| InChI | InChI=1S/C18H21N3O2/c22-17(23)15-11-18(12-20-15)6-9-21(10-7-18)16-14-4-2-1-3-13(14)5-8-19-16/h1-5,8,15,20H,6-7,9-12H2,(H,22,23) |
| InChIKey | PQXSSMDUXVDIBE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid?
The IUPAC name of 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid (CID 70720121) is 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid.
What is the SMILES notation for 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid?
The canonical SMILES for 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid is O=C(O)C1CC2(CCN(c3nccc4ccccc34)CC2)CN1.
What is the InChIKey of 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid?
The InChIKey is PQXSSMDUXVDIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2/c22-17(23)15-11-18(12-20-15)6-9-21(10-7-18)16-14-4-2-1-3-13(14)5-8-19-16/h1-5,8,15,20H,6-7,9-12H2,(H,22,23).
What are the key properties of 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid?
8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid has a molecular weight of 311.38 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-isoquinolin-1-yl-2,8-diazaspiro[4.5]decane-3-carboxylic acid is sourced from PubChem (CID 70720121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).