C21H33N3O3S — CID 70720310
1-[7-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one (PubChem CID 70720310) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[7-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one.
| Compound Name | 1-[7-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 70720310 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[7-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCc2ccc(S(=O)(=O)N3CCC(N(C)C)C3)cc2C1 |
| InChI | InChI=1S/C21H33N3O3S/c1-4-5-6-7-21(25)23-12-10-17-8-9-20(14-18(17)15-23)28(26,27)24-13-11-19(16-24)22(2)3/h8-9,14,19H,4-7,10-13,15-16H2,1-3H3 |
| InChIKey | JQHHWVDBFJQJRV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|