About 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid
2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid (PubChem CID 7072052) has the molecular formula C8H13NO6S
and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid |
| PubChem CID | 7072052 |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13NO6S/c10-7(11)3-9(4-8(12)13)6-1-2-16(14,15)5-6/h6H,1-5H2,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | BGCWFHXVBVYRBV-LURJTMIESA-N |
| XLogP | -1.36 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid?
The IUPAC name of 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid (CID 7072052) is 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid.
What is the SMILES notation for 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid?
The canonical SMILES for 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid is O=C(O)CN(CC(=O)O)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid?
The InChIKey is BGCWFHXVBVYRBV-LURJTMIESA-N. The full InChI is InChI=1S/C8H13NO6S/c10-7(11)3-9(4-8(12)13)6-1-2-16(14,15)5-6/h6H,1-5H2,(H,10,11)(H,12,13)/t6-/m0/s1.
What are the key properties of 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid?
2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid has a molecular weight of 251.26 g/mol, XLogP of -1.36, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxymethyl-[(3S)-1,1-dioxothiolan-3-yl]amino]acetic acid is sourced from PubChem (CID 7072052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).