C18H30N6OS — CID 70720670
[1-(4-aminocyclohexyl)triazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone (PubChem CID 70720670) has the molecular formula C18H30N6OS and a molecular weight of 378.55 g/mol. Its IUPAC name is [1-(4-aminocyclohexyl)triazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-aminocyclohexyl)triazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 70720670 |
| Molecular Formula | C18H30N6OS |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [1-(4-aminocyclohexyl)triazol-4-yl]-[4-(thian-4-yl)piperazin-1-yl]methanone |
| SMILES | NC1CCC(n2cc(C(=O)N3CCN(C4CCSCC4)CC3)nn2)CC1 |
| InChI | InChI=1S/C18H30N6OS/c19-14-1-3-16(4-2-14)24-13-17(20-21-24)18(25)23-9-7-22(8-10-23)15-5-11-26-12-6-15/h13-16H,1-12,19H2 |
| InChIKey | BZASCDRZZUTSRK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |