C20H26NO4P — CID 7072075
N-[(S)-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-phenylmethyl]-4-ethoxyaniline (PubChem CID 7072075) has the molecular formula C20H26NO4P and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[(S)-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-phenylmethyl]-4-ethoxyaniline.
| Compound Name | N-[(S)-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-phenylmethyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 7072075 |
| Molecular Formula | C20H26NO4P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(S)-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-phenylmethyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(N[C@H](c2ccccc2)P2(=O)OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C20H26NO4P/c1-4-23-18-12-10-17(11-13-18)21-19(16-8-6-5-7-9-16)26(22)24-14-20(2,3)15-25-26/h5-13,19,21H,4,14-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | AVPSBEVFDFNNAD-IBGZPJMESA-N |
| XLogP | 5.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|