C13H18N6O2S — CID 70721038
N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrimidin-2-amine (PubChem CID 70721038) has the molecular formula C13H18N6O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrimidin-2-amine.
| Compound Name | N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70721038 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[(5-methylsulfonyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methyl]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCCn2nc(CNc3ncccn3)cc2C1 |
| InChI | InChI=1S/C13H18N6O2S/c1-22(20,21)18-6-3-7-19-12(10-18)8-11(17-19)9-16-13-14-4-2-5-15-13/h2,4-5,8H,3,6-7,9-10H2,1H3,(H,14,15,16) |
| InChIKey | VHCMWLJTRZOLHC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |