C13H14N2O6S4-2 — CID 7072133
2-[(5Z)-2-oxo-4-sulfanylidene-5-[(2E)-2-[3-(3-sulfonatopropyl)-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetate (PubChem CID 7072133) has the molecular formula C13H14N2O6S4-2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[(5Z)-2-oxo-4-sulfanylidene-5-[(2E)-2-[3-(3-sulfonatopropyl)-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5Z)-2-oxo-4-sulfanylidene-5-[(2E)-2-[3-(3-sulfonatopropyl)-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 7072133 |
| Molecular Formula | C13H14N2O6S4-2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 2-[(5Z)-2-oxo-4-sulfanylidene-5-[(2E)-2-[3-(3-sulfonatopropyl)-1,3-thiazolidin-2-ylidene]ethylidene]-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)S/C(=C\C=C2\SCCN2CCCS(=O)(=O)[O-])C1=S |
| InChI | InChI=1S/C13H16N2O6S4/c16-11(17)8-15-12(22)9(24-13(15)18)2-3-10-14(5-6-23-10)4-1-7-25(19,20)21/h2-3H,1,4-8H2,(H,16,17)(H,19,20,21)/p-2/b9-2-,10-3+ |
| InChIKey | MYMKMLSKLNEZRI-WVFLHGFDSA-L |
| XLogP | -0.06 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|