C23H32N4O2 — CID 70721545
2-[[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]-8-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 70721545) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]-8-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]-8-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 70721545 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[[(4aS,8aR)-1-(3-methylbutyl)-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]methyl]-8-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccn2c(=O)cc(CN3CC[C@@H]4[C@@H](CCC(=O)N4CCC(C)C)C3)nc2c1 |
| InChI | InChI=1S/C23H32N4O2/c1-16(2)6-10-26-20-8-9-25(14-18(20)4-5-22(26)28)15-19-13-23(29)27-11-7-17(3)12-21(27)24-19/h7,11-13,16,18,20H,4-6,8-10,14-15H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | WKKPIBLFHJPDCR-AZUAARDMSA-N |
| XLogP | 2.86 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |