About 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine
5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 70721704) has the molecular formula C18H23N7
and a molecular weight of 337.43 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 70721704 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CCc1cc(N2CCN(c3cnccn3)CC2)n2nc(C)c(C)c2n1 |
| InChI | InChI=1S/C18H23N7/c1-4-15-11-17(25-18(21-15)13(2)14(3)22-25)24-9-7-23(8-10-24)16-12-19-5-6-20-16/h5-6,11-12H,4,7-10H2,1-3H3 |
| InChIKey | UNUCIYVESCJOTD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine (CID 70721704) is 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine is CCc1cc(N2CCN(c3cnccn3)CC2)n2nc(C)c(C)c2n1.
What is the InChIKey of 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is UNUCIYVESCJOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N7/c1-4-15-11-17(25-18(21-15)13(2)14(3)22-25)24-9-7-23(8-10-24)16-12-19-5-6-20-16/h5-6,11-12H,4,7-10H2,1-3H3.
What are the key properties of 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine?
5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 337.43 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dimethyl-7-(4-pyrazin-2-ylpiperazin-1-yl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 70721704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).