C19H28N2O2S — CID 70721730
(4aR,7aS)-1-(cyclopropylmethyl)-4-[(3,4-dimethylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70721730) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is (4aR,7aS)-1-(cyclopropylmethyl)-4-[(3,4-dimethylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(3,4-dimethylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70721730 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4aR,7aS)-1-(cyclopropylmethyl)-4-[(3,4-dimethylphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cc1ccc(CN2CCN(CC3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)cc1C |
| InChI | InChI=1S/C19H28N2O2S/c1-14-3-4-17(9-15(14)2)11-21-8-7-20(10-16-5-6-16)18-12-24(22,23)13-19(18)21/h3-4,9,16,18-19H,5-8,10-13H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | HYSMFMGCNJTHSZ-MOPGFXCFSA-N |
| XLogP | 2.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |