C9H7N2O3- — CID 7072201
4-acetyl-3-cyano-5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 7072201) has the molecular formula C9H7N2O3- and a molecular weight of 191.17 g/mol. Its IUPAC name is 4-acetyl-3-cyano-5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | 4-acetyl-3-cyano-5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 7072201 |
| Molecular Formula | C9H7N2O3- |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 4-acetyl-3-cyano-5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)[O-])c1C#N |
| InChI | InChI=1S/C9H8N2O3/c1-4-7(5(2)12)6(3-10)8(11-4)9(13)14/h11H,1-2H3,(H,13,14)/p-1 |
| InChIKey | VVTOECKHNOOUAT-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |