C18H22N4O3S — CID 70723038
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide (PubChem CID 70723038) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70723038 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-(2-ethoxyethyl)-2-oxo-3H-benzimidazole-5-carboxamide |
| SMILES | CCOCCn1c(=O)[nH]c2cc(C(=O)NCc3sc(C)nc3C)ccc21 |
| InChI | InChI=1S/C18H22N4O3S/c1-4-25-8-7-22-15-6-5-13(9-14(15)21-18(22)24)17(23)19-10-16-11(2)20-12(3)26-16/h5-6,9H,4,7-8,10H2,1-3H3,(H,19,23)(H,21,24) |
| InChIKey | SSNHJBRLCHFFHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|