C19H23N3O3S — CID 70724545
[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1H-indol-5-yl)methanone (PubChem CID 70724545) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 70724545 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(1H-indol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CCN(CC2CC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C19H23N3O3S/c23-19(15-3-4-16-14(9-15)5-6-20-16)22-8-7-21(10-13-1-2-13)17-11-26(24,25)12-18(17)22/h3-6,9,13,17-18,20H,1-2,7-8,10-12H2/t17-,18+/m1/s1 |
| InChIKey | YPQCWGMGLJTWGR-MSOLQXFVSA-N |
| XLogP | 1.50 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |