C17H21N3O3S — CID 70724648
(4aR,7aS)-4-(furan-3-ylmethyl)-1-(pyridin-4-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 70724648) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (4aR,7aS)-4-(furan-3-ylmethyl)-1-(pyridin-4-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(furan-3-ylmethyl)-1-(pyridin-4-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 70724648 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4aR,7aS)-4-(furan-3-ylmethyl)-1-(pyridin-4-ylmethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@H](C1)N(Cc1ccoc1)CCN2Cc1ccncc1 |
| InChI | InChI=1S/C17H21N3O3S/c21-24(22)12-16-17(13-24)20(10-15-3-8-23-11-15)7-6-19(16)9-14-1-4-18-5-2-14/h1-5,8,11,16-17H,6-7,9-10,12-13H2/t16-,17+/m1/s1 |
| InChIKey | WZWUCFMYLWMIRU-SJORKVTESA-N |
| XLogP | 1.16 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |