C17H28N2O3 — CID 70724677
3-(3-methylbutyl)-8-pent-4-enoyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 70724677) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-(3-methylbutyl)-8-pent-4-enoyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 3-(3-methylbutyl)-8-pent-4-enoyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 70724677 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3-(3-methylbutyl)-8-pent-4-enoyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | C=CCCC(=O)N1CCC2(CC1)CN(CCC(C)C)C(=O)O2 |
| InChI | InChI=1S/C17H28N2O3/c1-4-5-6-15(20)18-11-8-17(9-12-18)13-19(16(21)22-17)10-7-14(2)3/h4,14H,1,5-13H2,2-3H3 |
| InChIKey | AYQDXIHTLDLUEB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|