C20H33N5O — CID 70725303
(E)-1-[4-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one (PubChem CID 70725303) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is (E)-1-[4-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one.
| Compound Name | (E)-1-[4-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one |
|---|---|
| PubChem CID | 70725303 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | (E)-1-[4-[4-methyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]piperidin-1-yl]hex-3-en-1-one |
| SMILES | CC/C=C/CC(=O)N1CCC(c2nnc(CN3CCCCC3)n2C)CC1 |
| InChI | InChI=1S/C20H33N5O/c1-3-4-6-9-19(26)25-14-10-17(11-15-25)20-22-21-18(23(20)2)16-24-12-7-5-8-13-24/h4,6,17H,3,5,7-16H2,1-2H3/b6-4+ |
| InChIKey | JARBJXBIZCICPP-GQCTYLIASA-N |
| XLogP | 2.86 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|